C22H18Cl2F3N9O2 — CID 155055926
N-[3-[3-(4-chlorophenyl)-1-[[1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-oxo-1,2,4-triazol-4-yl]-1,1,1-trifluoropropan-2-yl]-3-iminopropanamide (PubChem CID 155055926) has the molecular formula C22H18Cl2F3N9O2 and a molecular weight of 568.35 g/mol. Its IUPAC name is N-[3-[3-(4-chlorophenyl)-1-[[1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-oxo-1,2,4-triazol-4-yl]-1,1,1-trifluoropropan-2-yl]-3-iminopropanamide.
| Compound Name | N-[3-[3-(4-chlorophenyl)-1-[[1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-oxo-1,2,4-triazol-4-yl]-1,1,1-trifluoropropan-2-yl]-3-iminopropanamide |
|---|---|
| PubChem CID | 155055926 |
| Molecular Formula | C22H18Cl2F3N9O2 |
| Molecular Weight | 568.35 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | N-[3-[3-(4-chlorophenyl)-1-[[1-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]methyl]-5-oxo-1,2,4-triazol-4-yl]-1,1,1-trifluoropropan-2-yl]-3-iminopropanamide |
| SMILES | [H]/N=C/CC(=O)NC(Cn1c(-c2ccc(Cl)cc2)nn(Cc2ncn(-c3ncccc3Cl)n2)c1=O)C(F)(F)F |
| InChI | InChI=1S/C22H18Cl2F3N9O2/c23-14-5-3-13(4-6-14)19-33-35(11-17-30-12-36(32-17)20-15(24)2-1-9-29-20)21(38)34(19)10-16(22(25,26)27)31-18(37)7-8-28/h1-6,8-9,12,16,28H,7,10-11H2,(H,31,37)/b28-8+ |
| InChIKey | IZNADJITWWZFHC-YLKCYHHESA-N |
| XLogP | 3.13 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|