C21H18ClF3N8O3 — CID 155071604
2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-methylpyridine-3-carboxamide (PubChem CID 155071604) has the molecular formula C21H18ClF3N8O3 and a molecular weight of 522.88 g/mol. Its IUPAC name is 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-methylpyridine-3-carboxamide.
| Compound Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155071604 |
| Molecular Formula | C21H18ClF3N8O3 |
| Molecular Weight | 522.88 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cccnc1-n1cnc(Cn2nc(-c3ccc(Cl)cc3)n(CC(O)C(F)(F)F)c2=O)n1 |
| InChI | InChI=1S/C21H18ClF3N8O3/c1-26-19(35)14-3-2-8-27-18(14)33-11-28-16(29-33)10-32-20(36)31(9-15(34)21(23,24)25)17(30-32)12-4-6-13(22)7-5-12/h2-8,11,15,34H,9-10H2,1H3,(H,26,35) |
| InChIKey | GZJJWMVSBJKTDA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.88 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |