C28H23ClF3N7O3 — CID 155165665
N-benzyl-2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]benzamide (PubChem CID 155165665) has the molecular formula C28H23ClF3N7O3 and a molecular weight of 597.99 g/mol. Its IUPAC name is N-benzyl-2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]benzamide.
| Compound Name | N-benzyl-2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]benzamide |
|---|---|
| PubChem CID | 155165665 |
| Molecular Formula | C28H23ClF3N7O3 |
| Molecular Weight | 597.99 g/mol |
| Exact Mass | 597.15 |
| IUPAC Name | N-benzyl-2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]benzamide |
| SMILES | O=C(NCc1ccccc1)c1ccccc1-n1cnc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)n1 |
| InChI | InChI=1S/C28H23ClF3N7O3/c29-20-12-10-19(11-13-20)25-36-38(27(42)37(25)15-23(40)28(30,31)32)16-24-34-17-39(35-24)22-9-5-4-8-21(22)26(41)33-14-18-6-2-1-3-7-18/h1-13,17,23,40H,14-16H2,(H,33,41)/t23-/m0/s1 |
| InChIKey | LGTIIWJIPUGWBN-QHCPKHFHSA-N |
| XLogP | 3.85 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.99 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |