C27H19ClF5N7O3 — CID 155165702
2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(2,5-difluorophenyl)benzamide (PubChem CID 155165702) has the molecular formula C27H19ClF5N7O3 and a molecular weight of 619.94 g/mol. Its IUPAC name is 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(2,5-difluorophenyl)benzamide.
| Compound Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(2,5-difluorophenyl)benzamide |
|---|---|
| PubChem CID | 155165702 |
| Molecular Formula | C27H19ClF5N7O3 |
| Molecular Weight | 619.94 g/mol |
| Exact Mass | 619.12 |
| IUPAC Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(2,5-difluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)ccc1F)c1ccccc1-n1cnc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)n1 |
| InChI | InChI=1S/C27H19ClF5N7O3/c28-16-7-5-15(6-8-16)24-37-39(26(43)38(24)12-22(41)27(31,32)33)13-23-34-14-40(36-23)21-4-2-1-3-18(21)25(42)35-20-11-17(29)9-10-19(20)30/h1-11,14,22,41H,12-13H2,(H,35,42)/t22-/m0/s1 |
| InChIKey | BUWYYVLVFRNDQE-QFIPXVFZSA-N |
| XLogP | 4.45 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.94 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |