C26H19ClF4N8O3 — CID 155165871
2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(5-fluoro-3-pyridinyl)benzamide (PubChem CID 155165871) has the molecular formula C26H19ClF4N8O3 and a molecular weight of 602.94 g/mol. Its IUPAC name is 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(5-fluoro-3-pyridinyl)benzamide.
| Compound Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(5-fluoro-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 155165871 |
| Molecular Formula | C26H19ClF4N8O3 |
| Molecular Weight | 602.94 g/mol |
| Exact Mass | 602.12 |
| IUPAC Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(5-fluoro-3-pyridinyl)benzamide |
| SMILES | O=C(Nc1cncc(F)c1)c1ccccc1-n1cnc(Cn2nc(-c3ccc(Cl)cc3)n(CC(O)C(F)(F)F)c2=O)n1 |
| InChI | InChI=1S/C26H19ClF4N8O3/c27-16-7-5-15(6-8-16)23-36-38(25(42)37(23)12-21(40)26(29,30)31)13-22-33-14-39(35-22)20-4-2-1-3-19(20)24(41)34-18-9-17(28)10-32-11-18/h1-11,14,21,40H,12-13H2,(H,34,41) |
| InChIKey | HLWUJIMNGCVYRM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.94 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |