C28H29ClF3N7O3 — CID 155165740
2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(4-methylcyclohexyl)benzamide (PubChem CID 155165740) has the molecular formula C28H29ClF3N7O3 and a molecular weight of 604.03 g/mol. Its IUPAC name is 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(4-methylcyclohexyl)benzamide.
| Compound Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(4-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 155165740 |
| Molecular Formula | C28H29ClF3N7O3 |
| Molecular Weight | 604.03 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(4-methylcyclohexyl)benzamide |
| SMILES | CC1CCC(NC(=O)c2ccccc2-n2cnc(Cn3nc(-c4ccc(Cl)cc4)n(CC(O)C(F)(F)F)c3=O)n2)CC1 |
| InChI | InChI=1S/C28H29ClF3N7O3/c1-17-6-12-20(13-7-17)34-26(41)21-4-2-3-5-22(21)39-16-33-24(35-39)15-38-27(42)37(14-23(40)28(30,31)32)25(36-38)18-8-10-19(29)11-9-18/h2-5,8-11,16-17,20,23,40H,6-7,12-15H2,1H3,(H,34,41) |
| InChIKey | JWMLXYMDOTXNJH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.03 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |