C26H24ClF3N8O4 — CID 155071590
2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]benzamide (PubChem CID 155071590) has the molecular formula C26H24ClF3N8O4 and a molecular weight of 604.98 g/mol. Its IUPAC name is 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]benzamide.
| Compound Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 155071590 |
| Molecular Formula | C26H24ClF3N8O4 |
| Molecular Weight | 604.98 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]benzamide |
| SMILES | O=C1CC[C@@H](CNC(=O)c2ccccc2-n2cnc(Cn3nc(-c4ccc(Cl)cc4)n(C[C@H](O)C(F)(F)F)c3=O)n2)N1 |
| InChI | InChI=1S/C26H24ClF3N8O4/c27-16-7-5-15(6-8-16)23-35-37(25(42)36(23)12-20(39)26(28,29)30)13-21-32-14-38(34-21)19-4-2-1-3-18(19)24(41)31-11-17-9-10-22(40)33-17/h1-8,14,17,20,39H,9-13H2,(H,31,41)(H,33,40)/t17-,20-/m0/s1 |
| InChIKey | OXHFAVPHXGEEJK-PXNSSMCTSA-N |
| XLogP | 1.93 |
| TPSA | 148.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.98 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |