C25H23ClF3N7O4 — CID 142564731
2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(oxolan-3-yl)benzamide (PubChem CID 142564731) has the molecular formula C25H23ClF3N7O4 and a molecular weight of 577.95 g/mol. Its IUPAC name is 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(oxolan-3-yl)benzamide.
| Compound Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(oxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 142564731 |
| Molecular Formula | C25H23ClF3N7O4 |
| Molecular Weight | 577.95 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(oxolan-3-yl)benzamide |
| SMILES | O=C(NC1CCOC1)c1ccccc1-n1cnc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)n1 |
| InChI | InChI=1S/C25H23ClF3N7O4/c26-16-7-5-15(6-8-16)22-33-35(24(39)34(22)11-20(37)25(27,28)29)12-21-30-14-36(32-21)19-4-2-1-3-18(19)23(38)31-17-9-10-40-13-17/h1-8,14,17,20,37H,9-13H2,(H,31,38)/t17?,20-/m0/s1 |
| InChIKey | UNVUPVPGSYORCJ-OZBJMMHXSA-N |
| XLogP | 2.44 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.95 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |