C26H25ClF3N7O4 — CID 155071469
2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-[(3-methyloxetan-3-yl)methyl]benzamide (PubChem CID 155071469) has the molecular formula C26H25ClF3N7O4 and a molecular weight of 591.98 g/mol. Its IUPAC name is 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-[(3-methyloxetan-3-yl)methyl]benzamide.
| Compound Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-[(3-methyloxetan-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 155071469 |
| Molecular Formula | C26H25ClF3N7O4 |
| Molecular Weight | 591.98 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-[(3-methyloxetan-3-yl)methyl]benzamide |
| SMILES | CC1(CNC(=O)c2ccccc2-n2cnc(Cn3nc(-c4ccc(Cl)cc4)n(CC(O)C(F)(F)F)c3=O)n2)COC1 |
| InChI | InChI=1S/C26H25ClF3N7O4/c1-25(13-41-14-25)12-31-23(39)18-4-2-3-5-19(18)37-15-32-21(33-37)11-36-24(40)35(10-20(38)26(28,29)30)22(34-36)16-6-8-17(27)9-7-16/h2-9,15,20,38H,10-14H2,1H3,(H,31,39) |
| InChIKey | XXMIMTZNTFJZRS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.98 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |