C24H20ClF6N7O3 — CID 155071387
2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(3,3,3-trifluoropropyl)benzamide (PubChem CID 155071387) has the molecular formula C24H20ClF6N7O3 and a molecular weight of 603.91 g/mol. Its IUPAC name is 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(3,3,3-trifluoropropyl)benzamide.
| Compound Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(3,3,3-trifluoropropyl)benzamide |
|---|---|
| PubChem CID | 155071387 |
| Molecular Formula | C24H20ClF6N7O3 |
| Molecular Weight | 603.91 g/mol |
| Exact Mass | 603.12 |
| IUPAC Name | 2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-N-(3,3,3-trifluoropropyl)benzamide |
| SMILES | O=C(NCCC(F)(F)F)c1ccccc1-n1cnc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)n1 |
| InChI | InChI=1S/C24H20ClF6N7O3/c25-15-7-5-14(6-8-15)20-35-37(22(41)36(20)11-18(39)24(29,30)31)12-19-33-13-38(34-19)17-4-2-1-3-16(17)21(40)32-10-9-23(26,27)28/h1-8,13,18,39H,9-12H2,(H,32,40)/t18-/m0/s1 |
| InChIKey | IINVQXMPZDOXDE-SFHVURJKSA-N |
| XLogP | 3.60 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.91 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |