C27H22ClF3N8O3 — CID 155165733
N-(4-aminophenyl)-2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]benzamide (PubChem CID 155165733) has the molecular formula C27H22ClF3N8O3 and a molecular weight of 598.97 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]benzamide.
| Compound Name | N-(4-aminophenyl)-2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]benzamide |
|---|---|
| PubChem CID | 155165733 |
| Molecular Formula | C27H22ClF3N8O3 |
| Molecular Weight | 598.97 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | N-(4-aminophenyl)-2-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoro-2-hydroxypropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]benzamide |
| SMILES | Nc1ccc(NC(=O)c2ccccc2-n2cnc(Cn3nc(-c4ccc(Cl)cc4)n(CC(O)C(F)(F)F)c3=O)n2)cc1 |
| InChI | InChI=1S/C27H22ClF3N8O3/c28-17-7-5-16(6-8-17)24-36-38(26(42)37(24)13-22(40)27(29,30)31)14-23-33-15-39(35-23)21-4-2-1-3-20(21)25(41)34-19-11-9-18(32)10-12-19/h1-12,15,22,40H,13-14,32H2,(H,34,41) |
| InChIKey | LJMRMOADJHPPOZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 145.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.97 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|