C23H20ClF3N8O3S — CID 151450238
N-[2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-3-pyridinyl]thietane-3-carboxamide (PubChem CID 151450238) has the molecular formula C23H20ClF3N8O3S and a molecular weight of 580.98 g/mol. Its IUPAC name is N-[2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-3-pyridinyl]thietane-3-carboxamide.
| Compound Name | N-[2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-3-pyridinyl]thietane-3-carboxamide |
|---|---|
| PubChem CID | 151450238 |
| Molecular Formula | C23H20ClF3N8O3S |
| Molecular Weight | 580.98 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | N-[2-[3-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]-3-pyridinyl]thietane-3-carboxamide |
| SMILES | O=C(Nc1cccnc1-n1cnc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)n1)C1CSC1 |
| InChI | InChI=1S/C23H20ClF3N8O3S/c24-15-5-3-13(4-6-15)19-32-34(22(38)33(19)8-17(36)23(25,26)27)9-18-29-12-35(31-18)20-16(2-1-7-28-20)30-21(37)14-10-39-11-14/h1-7,12,14,17,36H,8-11H2,(H,30,37)/t17-/m0/s1 |
| InChIKey | PGIRJXLIAIBTMN-KRWDZBQOSA-N |
| XLogP | 2.61 |
| TPSA | 132.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.98 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |