C23H21ClF3N7O5S — CID 160713981
5-(4-chlorophenyl)-2-[[1-[3-(3-methylsulfonyl-2-oxopropyl)-2-pyridinyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 160713981) has the molecular formula C23H21ClF3N7O5S and a molecular weight of 599.98 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[1-[3-(3-methylsulfonyl-2-oxopropyl)-2-pyridinyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[1-[3-(3-methylsulfonyl-2-oxopropyl)-2-pyridinyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 160713981 |
| Molecular Formula | C23H21ClF3N7O5S |
| Molecular Weight | 599.98 g/mol |
| Exact Mass | 599.10 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[1-[3-(3-methylsulfonyl-2-oxopropyl)-2-pyridinyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | CS(=O)(=O)CC(=O)Cc1cccnc1-n1cnc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)n1 |
| InChI | InChI=1S/C23H21ClF3N7O5S/c1-40(38,39)12-17(35)9-15-3-2-8-28-20(15)34-13-29-19(30-34)11-33-22(37)32(10-18(36)23(25,26)27)21(31-33)14-4-6-16(24)7-5-14/h2-8,13,18,36H,9-12H2,1H3/t18-/m0/s1 |
| InChIKey | RSFNLFQGUFFEEN-SFHVURJKSA-N |
| XLogP | 1.47 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.98 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |