C22H15ClF6N7O6P-2 — CID 142563951
[(2S)-3-[1-[[5-carbamoyl-1-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-3-(4-chlorophenyl)-5-oxo-1,2,4-triazol-4-yl]-1,1,1-trifluoropropan-2-yl] phosphate (PubChem CID 142563951) has the molecular formula C22H15ClF6N7O6P-2 and a molecular weight of 653.82 g/mol. Its IUPAC name is [(2S)-3-[1-[[5-carbamoyl-1-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-3-(4-chlorophenyl)-5-oxo-1,2,4-triazol-4-yl]-1,1,1-trifluoropropan-2-yl] phosphate.
| Compound Name | [(2S)-3-[1-[[5-carbamoyl-1-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-3-(4-chlorophenyl)-5-oxo-1,2,4-triazol-4-yl]-1,1,1-trifluoropropan-2-yl] phosphate |
|---|---|
| PubChem CID | 142563951 |
| Molecular Formula | C22H15ClF6N7O6P-2 |
| Molecular Weight | 653.82 g/mol |
| Exact Mass | 653.04 |
| IUPAC Name | [(2S)-3-[1-[[5-carbamoyl-1-[2-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]methyl]-3-(4-chlorophenyl)-5-oxo-1,2,4-triazol-4-yl]-1,1,1-trifluoropropan-2-yl] phosphate |
| SMILES | NC(=O)c1nc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](OP(=O)([O-])[O-])C(F)(F)F)c2=O)nn1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H17ClF6N7O6P/c23-12-7-5-11(6-8-12)18-33-35(20(38)34(18)9-15(22(27,28)29)42-43(39,40)41)10-16-31-19(17(30)37)36(32-16)14-4-2-1-3-13(14)21(24,25)26/h1-8,15H,9-10H2,(H2,30,37)(H2,39,40,41)/p-2/t15-/m0/s1 |
| InChIKey | MXQKGHNSEIYLIN-HNNXBMFYSA-L |
| XLogP | 1.89 |
| TPSA | 186.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.82 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|