C21H17ClF4N6O2 — CID 145075303
5-(4-chlorophenyl)-2-[[1-(3-fluorophenyl)-5-(hydroxymethyl)-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-one (PubChem CID 145075303) has the molecular formula C21H17ClF4N6O2 and a molecular weight of 496.85 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[1-(3-fluorophenyl)-5-(hydroxymethyl)-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[1-(3-fluorophenyl)-5-(hydroxymethyl)-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 145075303 |
| Molecular Formula | C21H17ClF4N6O2 |
| Molecular Weight | 496.85 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[1-(3-fluorophenyl)-5-(hydroxymethyl)-1,2,4-triazol-3-yl]methyl]-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-one |
| SMILES | O=c1n(Cc2nc(CO)n(-c3cccc(F)c3)n2)nc(-c2ccc(Cl)cc2)n1CCC(F)(F)F |
| InChI | InChI=1S/C21H17ClF4N6O2/c22-14-6-4-13(5-7-14)19-29-31(20(34)30(19)9-8-21(24,25)26)11-17-27-18(12-33)32(28-17)16-3-1-2-15(23)10-16/h1-7,10,33H,8-9,11-12H2 |
| InChIKey | LOHKDAYDCQICKS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.85 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |