C22H18Cl2F3N7O3 — CID 134460126
methyl 2-[5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-1-yl]methyl]-2-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]acetate (PubChem CID 134460126) has the molecular formula C22H18Cl2F3N7O3 and a molecular weight of 556.33 g/mol. Its IUPAC name is methyl 2-[5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-1-yl]methyl]-2-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]acetate.
| Compound Name | methyl 2-[5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-1-yl]methyl]-2-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]acetate |
|---|---|
| PubChem CID | 134460126 |
| Molecular Formula | C22H18Cl2F3N7O3 |
| Molecular Weight | 556.33 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | methyl 2-[5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-1-yl]methyl]-2-(3-chloro-2-pyridinyl)-1,2,4-triazol-3-yl]acetate |
| SMILES | COC(=O)Cc1nc(Cn2nc(-c3ccc(Cl)cc3)n(CCC(F)(F)F)c2=O)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C22H18Cl2F3N7O3/c1-37-18(35)11-17-29-16(30-34(17)20-15(24)3-2-9-28-20)12-33-21(36)32(10-8-22(25,26)27)19(31-33)13-4-6-14(23)7-5-13/h2-7,9H,8,10-12H2,1H3 |
| InChIKey | ASNQACJHBMPIJN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |