C22H21ClF3N9O3 — CID 145395337
3-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-1-yl]methyl]-5-formyl-1,2,4-triazol-1-yl]pyridine-4-carboxamide;methanamine (PubChem CID 145395337) has the molecular formula C22H21ClF3N9O3 and a molecular weight of 551.92 g/mol. Its IUPAC name is 3-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-1-yl]methyl]-5-formyl-1,2,4-triazol-1-yl]pyridine-4-carboxamide;methanamine.
| Compound Name | 3-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-1-yl]methyl]-5-formyl-1,2,4-triazol-1-yl]pyridine-4-carboxamide;methanamine |
|---|---|
| PubChem CID | 145395337 |
| Molecular Formula | C22H21ClF3N9O3 |
| Molecular Weight | 551.92 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 3-[3-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-1-yl]methyl]-5-formyl-1,2,4-triazol-1-yl]pyridine-4-carboxamide;methanamine |
| SMILES | CN.NC(=O)c1ccncc1-n1nc(Cn2nc(-c3ccc(Cl)cc3)n(CCC(F)(F)F)c2=O)nc1C=O |
| InChI | InChI=1S/C21H16ClF3N8O3.CH5N/c22-13-3-1-12(2-4-13)19-30-32(20(36)31(19)8-6-21(23,24)25)10-16-28-17(11-34)33(29-16)15-9-27-7-5-14(15)18(26)35;1-2/h1-5,7,9,11H,6,8,10H2,(H2,26,35);2H2,1H3 |
| InChIKey | FGHGQYROJCLDEK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 169.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.92 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|