C16H13ClF6N6O2 — CID 134460140
5-(4-chlorophenyl)-2-[[3-(2,2,2-trifluoro-1-hydroxyethyl)-1H-1,2,4-triazol-5-yl]methyl]-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-one (PubChem CID 134460140) has the molecular formula C16H13ClF6N6O2 and a molecular weight of 470.76 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[3-(2,2,2-trifluoro-1-hydroxyethyl)-1H-1,2,4-triazol-5-yl]methyl]-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[3-(2,2,2-trifluoro-1-hydroxyethyl)-1H-1,2,4-triazol-5-yl]methyl]-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 134460140 |
| Molecular Formula | C16H13ClF6N6O2 |
| Molecular Weight | 470.76 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[3-(2,2,2-trifluoro-1-hydroxyethyl)-1H-1,2,4-triazol-5-yl]methyl]-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-one |
| SMILES | O=c1n(Cc2nc(C(O)C(F)(F)F)n[nH]2)nc(-c2ccc(Cl)cc2)n1CCC(F)(F)F |
| InChI | InChI=1S/C16H13ClF6N6O2/c17-9-3-1-8(2-4-9)13-27-29(14(31)28(13)6-5-15(18,19)20)7-10-24-12(26-25-10)11(30)16(21,22)23/h1-4,11,30H,5-7H2,(H,24,25,26) |
| InChIKey | VFIYJPARNMWEJW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.76 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |