C14H11ClF3N3O — CID 129090435
5-(4-chlorophenyl)-2-prop-2-ynyl-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-one (PubChem CID 129090435) has the molecular formula C14H11ClF3N3O and a molecular weight of 329.71 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-prop-2-ynyl-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-prop-2-ynyl-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 129090435 |
| Molecular Formula | C14H11ClF3N3O |
| Molecular Weight | 329.71 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 5-(4-chlorophenyl)-2-prop-2-ynyl-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-one |
| SMILES | C#CCn1nc(-c2ccc(Cl)cc2)n(CCC(F)(F)F)c1=O |
| InChI | InChI=1S/C14H11ClF3N3O/c1-2-8-21-13(22)20(9-7-14(16,17)18)12(19-21)10-3-5-11(15)6-4-10/h1,3-6H,7-9H2 |
| InChIKey | LYYQNCCTBCMFTO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.71 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|