C22H18Cl2F3N7O2 — CID 129090471
2-[3-(2-chlorophenyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]acetamide (PubChem CID 129090471) has the molecular formula C22H18Cl2F3N7O2 and a molecular weight of 540.33 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]acetamide.
| Compound Name | 2-[3-(2-chlorophenyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 129090471 |
| Molecular Formula | C22H18Cl2F3N7O2 |
| Molecular Weight | 540.33 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-1-yl]acetamide |
| SMILES | NC(=O)Cn1nc(-c2ccccc2Cl)nc1Cn1nc(-c2ccc(Cl)cc2)n(CCC(F)(F)F)c1=O |
| InChI | InChI=1S/C22H18Cl2F3N7O2/c23-14-7-5-13(6-8-14)20-31-34(21(36)32(20)10-9-22(25,26)27)12-18-29-19(30-33(18)11-17(28)35)15-3-1-2-4-16(15)24/h1-8H,9-12H2,(H2,28,35) |
| InChIKey | AUILJODLUZNHKG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |