C15H13ClF3N7O3 — CID 142563925
5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 142563925) has the molecular formula C15H13ClF3N7O3 and a molecular weight of 431.76 g/mol. Its IUPAC name is 5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 142563925 |
| Molecular Formula | C15H13ClF3N7O3 |
| Molecular Weight | 431.76 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1n[nH]c(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)n1 |
| InChI | InChI=1S/C15H13ClF3N7O3/c16-8-3-1-7(2-4-8)13-24-26(6-10-21-12(11(20)28)23-22-10)14(29)25(13)5-9(27)15(17,18)19/h1-4,9,27H,5-6H2,(H2,20,28)(H,21,22,23)/t9-/m0/s1 |
| InChIKey | PBKFNLFPWVCBNW-VIFPVBQESA-N |
| XLogP | 0.55 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.76 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |