C24H20Cl2F4N6O4 — CID 155126082
1-[2-(2-chloro-4-fluorophenyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-3-yl]ethyl acetate (PubChem CID 155126082) has the molecular formula C24H20Cl2F4N6O4 and a molecular weight of 603.36 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-3-yl]ethyl acetate.
| Compound Name | 1-[2-(2-chloro-4-fluorophenyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-3-yl]ethyl acetate |
|---|---|
| PubChem CID | 155126082 |
| Molecular Formula | C24H20Cl2F4N6O4 |
| Molecular Weight | 603.36 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenyl)-5-[[3-(4-chlorophenyl)-5-oxo-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-1-yl]methyl]-1,2,4-triazol-3-yl]ethyl acetate |
| SMILES | CC(=O)OC(C)c1nc(Cn2nc(-c3ccc(Cl)cc3)n(C[C@H](O)C(F)(F)F)c2=O)nn1-c1ccc(F)cc1Cl |
| InChI | InChI=1S/C24H20Cl2F4N6O4/c1-12(40-13(2)37)21-31-20(32-36(21)18-8-7-16(27)9-17(18)26)11-35-23(39)34(10-19(38)24(28,29)30)22(33-35)14-3-5-15(25)6-4-14/h3-9,12,19,38H,10-11H2,1-2H3/t12?,19-/m0/s1 |
| InChIKey | MAAYUWVLLYAMKN-RKLCOFROSA-N |
| XLogP | 4.33 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.36 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |