C13H14N2O3S — CID 175297408
4-amino-2-[4-(hydroxymethyl)phenyl]benzenesulfonamide (PubChem CID 175297408) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 4-amino-2-[4-(hydroxymethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-amino-2-[4-(hydroxymethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175297408 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 4-amino-2-[4-(hydroxymethyl)phenyl]benzenesulfonamide |
| SMILES | Nc1ccc(S(N)(=O)=O)c(-c2ccc(CO)cc2)c1 |
| InChI | InChI=1S/C13H14N2O3S/c14-11-5-6-13(19(15,17)18)12(7-11)10-3-1-9(8-16)2-4-10/h1-7,16H,8,14H2,(H2,15,17,18) |
| InChIKey | JFTHFLTYAUKFHI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|