C15H21NO4 — CID 175297519
[2-methoxy-6-(2-oxopropyl)anilino] 2,2-dimethylpropanoate (PubChem CID 175297519) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is [2-methoxy-6-(2-oxopropyl)anilino] 2,2-dimethylpropanoate.
| Compound Name | [2-methoxy-6-(2-oxopropyl)anilino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175297519 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [2-methoxy-6-(2-oxopropyl)anilino] 2,2-dimethylpropanoate |
| SMILES | COc1cccc(CC(C)=O)c1NOC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H21NO4/c1-10(17)9-11-7-6-8-12(19-5)13(11)16-20-14(18)15(2,3)4/h6-8,16H,9H2,1-5H3 |
| InChIKey | JESRVTATRGSYCP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|