C22H44O5 — CID 175297629
butane-1,1-diol;(Z)-12-hydroxyoctadec-9-enoic acid (PubChem CID 175297629) has the molecular formula C22H44O5 and a molecular weight of 388.59 g/mol. Its IUPAC name is butane-1,1-diol;(Z)-12-hydroxyoctadec-9-enoic acid.
| Compound Name | butane-1,1-diol;(Z)-12-hydroxyoctadec-9-enoic acid |
|---|---|
| PubChem CID | 175297629 |
| Molecular Formula | C22H44O5 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | butane-1,1-diol;(Z)-12-hydroxyoctadec-9-enoic acid |
| SMILES | CCCC(O)O.CCCCCCC(O)C/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O3.C4H10O2/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;1-2-3-4(5)6/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);4-6H,2-3H2,1H3/b12-9-; |
| InChIKey | OCFHCVSJAPMAIZ-MWMYENNMSA-N |
| XLogP | 5.18 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|