C9H4Br4N2 — CID 175299716
2,4,5,6-tetrabromo-1,4-benzodiazepine (PubChem CID 175299716) has the molecular formula C9H4Br4N2 and a molecular weight of 459.76 g/mol. Its IUPAC name is 2,4,5,6-tetrabromo-1,4-benzodiazepine.
| Compound Name | 2,4,5,6-tetrabromo-1,4-benzodiazepine |
|---|---|
| PubChem CID | 175299716 |
| Molecular Formula | C9H4Br4N2 |
| Molecular Weight | 459.76 g/mol |
| Exact Mass | 455.71 |
| IUPAC Name | 2,4,5,6-tetrabromo-1,4-benzodiazepine |
| SMILES | BrC1=CN(Br)C(Br)=c2c(Br)cccc2=N1 |
| InChI | InChI=1S/C9H4Br4N2/c10-5-2-1-3-6-8(5)9(12)15(13)4-7(11)14-6/h1-4H |
| InChIKey | VXJKXUNDVNJVGE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.76 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|