C13H16N2O4 — CID 175299823
(3-amino-2-hydroxybenzoyl) (2R)-1-methylpyrrolidine-2-carboxylate (PubChem CID 175299823) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is (3-amino-2-hydroxybenzoyl) (2R)-1-methylpyrrolidine-2-carboxylate.
| Compound Name | (3-amino-2-hydroxybenzoyl) (2R)-1-methylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 175299823 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (3-amino-2-hydroxybenzoyl) (2R)-1-methylpyrrolidine-2-carboxylate |
| SMILES | CN1CCC[C@@H]1C(=O)OC(=O)c1cccc(N)c1O |
| InChI | InChI=1S/C13H16N2O4/c1-15-7-3-6-10(15)13(18)19-12(17)8-4-2-5-9(14)11(8)16/h2,4-5,10,16H,3,6-7,14H2,1H3/t10-/m1/s1 |
| InChIKey | OCZZSZATKGJDOQ-SNVBAGLBSA-N |
| XLogP | 0.75 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|