C17H25ClN4O — CID 175301043
2,3-dimethyl-N-piperidin-4-ylquinolin-5-amine;formamide;hydrochloride (PubChem CID 175301043) has the molecular formula C17H25ClN4O and a molecular weight of 336.87 g/mol. Its IUPAC name is 2,3-dimethyl-N-piperidin-4-ylquinolin-5-amine;formamide;hydrochloride.
| Compound Name | 2,3-dimethyl-N-piperidin-4-ylquinolin-5-amine;formamide;hydrochloride |
|---|---|
| PubChem CID | 175301043 |
| Molecular Formula | C17H25ClN4O |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2,3-dimethyl-N-piperidin-4-ylquinolin-5-amine;formamide;hydrochloride |
| SMILES | Cc1cc2c(NC3CCNCC3)cccc2nc1C.Cl.NC=O |
| InChI | InChI=1S/C16H21N3.CH3NO.ClH/c1-11-10-14-15(18-12(11)2)4-3-5-16(14)19-13-6-8-17-9-7-13;2-1-3;/h3-5,10,13,17,19H,6-9H2,1-2H3;1H,(H2,2,3);1H |
| InChIKey | BGCQTOILTFROOT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|