C16H24N2 — CID 175301373
2-N,2-N-bis(prop-2-enyl)benzene-1,2-diamine;but-1-ene (PubChem CID 175301373) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-N,2-N-bis(prop-2-enyl)benzene-1,2-diamine;but-1-ene.
| Compound Name | 2-N,2-N-bis(prop-2-enyl)benzene-1,2-diamine;but-1-ene |
|---|---|
| PubChem CID | 175301373 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-N,2-N-bis(prop-2-enyl)benzene-1,2-diamine;but-1-ene |
| SMILES | C=CCC.C=CCN(CC=C)c1ccccc1N |
| InChI | InChI=1S/C12H16N2.C4H8/c1-3-9-14(10-4-2)12-8-6-5-7-11(12)13;1-3-4-2/h3-8H,1-2,9-10,13H2;3H,1,4H2,2H3 |
| InChIKey | MCPWPUMNDJFGNN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|