About azane;trimethyl(octyl)azanium;bromide
azane;trimethyl(octyl)azanium;bromide (PubChem CID 175301747) has the molecular formula C11H29BrN2
and a molecular weight of 269.27 g/mol. Its IUPAC name is azane;trimethyl(octyl)azanium;bromide.
Molecular Properties
| Compound Name | azane;trimethyl(octyl)azanium;bromide |
| PubChem CID | 175301747 |
| Molecular Formula | C11H29BrN2 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | azane;trimethyl(octyl)azanium;bromide |
| SMILES | CCCCCCCC[N+](C)(C)C.N.[Br-] |
| InChI | InChI=1S/C11H26N.BrH.H3N/c1-5-6-7-8-9-10-11-12(2,3)4;;/h5-11H2,1-4H3;1H;1H3/q+1;;/p-1 |
| InChIKey | SDBMCBUHDJBKQQ-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze azane;trimethyl(octyl)azanium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;trimethyl(octyl)azanium;bromide?
The IUPAC name of azane;trimethyl(octyl)azanium;bromide (CID 175301747) is azane;trimethyl(octyl)azanium;bromide.
What is the SMILES notation for azane;trimethyl(octyl)azanium;bromide?
The canonical SMILES for azane;trimethyl(octyl)azanium;bromide is CCCCCCCC[N+](C)(C)C.N.[Br-].
What is the InChIKey of azane;trimethyl(octyl)azanium;bromide?
The InChIKey is SDBMCBUHDJBKQQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H26N.BrH.H3N/c1-5-6-7-8-9-10-11-12(2,3)4;;/h5-11H2,1-4H3;1H;1H3/q+1;;/p-1.
What are the key properties of azane;trimethyl(octyl)azanium;bromide?
azane;trimethyl(octyl)azanium;bromide has a molecular weight of 269.27 g/mol, XLogP of 0.22, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;trimethyl(octyl)azanium;bromide is sourced from PubChem (CID 175301747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).