About azane;decyl(trimethyl)azanium;hydrate
azane;decyl(trimethyl)azanium;hydrate (PubChem CID 174762384) has the molecular formula C13H35N2O+
and a molecular weight of 235.44 g/mol. Its IUPAC name is azane;decyl(trimethyl)azanium;hydrate.
Molecular Properties
| Compound Name | azane;decyl(trimethyl)azanium;hydrate |
| PubChem CID | 174762384 |
| Molecular Formula | C13H35N2O+ |
| Molecular Weight | 235.44 g/mol |
| Exact Mass | 235.27 |
| IUPAC Name | azane;decyl(trimethyl)azanium;hydrate |
| SMILES | CCCCCCCCCC[N+](C)(C)C.N.O |
| InChI | InChI=1S/C13H30N.H3N.H2O/c1-5-6-7-8-9-10-11-12-13-14(2,3)4;;/h5-13H2,1-4H3;1H3;1H2/q+1;; |
| InChIKey | INWDFDYORPMFRP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze azane;decyl(trimethyl)azanium;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;decyl(trimethyl)azanium;hydrate?
The IUPAC name of azane;decyl(trimethyl)azanium;hydrate (CID 174762384) is azane;decyl(trimethyl)azanium;hydrate.
What is the SMILES notation for azane;decyl(trimethyl)azanium;hydrate?
The canonical SMILES for azane;decyl(trimethyl)azanium;hydrate is CCCCCCCCCC[N+](C)(C)C.N.O.
What is the InChIKey of azane;decyl(trimethyl)azanium;hydrate?
The InChIKey is INWDFDYORPMFRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N.H3N.H2O/c1-5-6-7-8-9-10-11-12-13-14(2,3)4;;/h5-13H2,1-4H3;1H3;1H2/q+1;;.
What are the key properties of azane;decyl(trimethyl)azanium;hydrate?
azane;decyl(trimethyl)azanium;hydrate has a molecular weight of 235.44 g/mol, XLogP of 3.17, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;decyl(trimethyl)azanium;hydrate is sourced from PubChem (CID 174762384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).