C15H24N2O8 — CID 175302430
2-(5-amino-2-oxopentanoyl)-2-(butoxycarbonylamino)pentanedioic acid (PubChem CID 175302430) has the molecular formula C15H24N2O8 and a molecular weight of 360.36 g/mol. Its IUPAC name is 2-(5-amino-2-oxopentanoyl)-2-(butoxycarbonylamino)pentanedioic acid.
| Compound Name | 2-(5-amino-2-oxopentanoyl)-2-(butoxycarbonylamino)pentanedioic acid |
|---|---|
| PubChem CID | 175302430 |
| Molecular Formula | C15H24N2O8 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-(5-amino-2-oxopentanoyl)-2-(butoxycarbonylamino)pentanedioic acid |
| SMILES | CCCCOC(=O)NC(CCC(=O)O)(C(=O)O)C(=O)C(=O)CCCN |
| InChI | InChI=1S/C15H24N2O8/c1-2-3-9-25-14(24)17-15(13(22)23,7-6-11(19)20)12(21)10(18)5-4-8-16/h2-9,16H2,1H3,(H,17,24)(H,19,20)(H,22,23) |
| InChIKey | CPJKYWYVFKGEKA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 173.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|