C13H19N6O5+ — CID 175303837
2-amino-4-(2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid;4-amino-3-methyl-1H-pyrimidin-3-ium-2-one (PubChem CID 175303837) has the molecular formula C13H19N6O5+ and a molecular weight of 339.33 g/mol. Its IUPAC name is 2-amino-4-(2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid;4-amino-3-methyl-1H-pyrimidin-3-ium-2-one.
| Compound Name | 2-amino-4-(2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid;4-amino-3-methyl-1H-pyrimidin-3-ium-2-one |
|---|---|
| PubChem CID | 175303837 |
| Molecular Formula | C13H19N6O5+ |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-amino-4-(2,4-dioxo-1H-pyrimidin-3-yl)butanoic acid;4-amino-3-methyl-1H-pyrimidin-3-ium-2-one |
| SMILES | C[n+]1c(N)cc[nH]c1=O.NC(CCn1c(=O)cc[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C8H11N3O4.C5H7N3O/c9-5(7(13)14)2-4-11-6(12)1-3-10-8(11)15;1-8-4(6)2-3-7-5(8)9/h1,3,5H,2,4,9H2,(H,10,15)(H,13,14);2-3H,1H3,(H2,6,7,9)/p+1 |
| InChIKey | CURKTYRWKJKKNO-UHFFFAOYSA-O |
| XLogP | -2.88 |
| TPSA | 180.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|