C10H15N5O4 — CID 102467211
2-amino-4-[[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]butanoic acid (PubChem CID 102467211) has the molecular formula C10H15N5O4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-amino-4-[[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]butanoic acid.
| Compound Name | 2-amino-4-[[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 102467211 |
| Molecular Formula | C10H15N5O4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-amino-4-[[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]butanoic acid |
| SMILES | Nc1ccn(CC(=O)NCCC(N)C(=O)O)c(=O)n1 |
| InChI | InChI=1S/C10H15N5O4/c11-6(9(17)18)1-3-13-8(16)5-15-4-2-7(12)14-10(15)19/h2,4,6H,1,3,5,11H2,(H,13,16)(H,17,18)(H2,12,14,19) |
| InChIKey | VHNSULYSXDMLHK-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |