C8H14N4O2 — CID 22326385
2-amino-4-(4-amino-2H-pyrimidin-1-yl)butanoic acid (PubChem CID 22326385) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-amino-4-(4-amino-2H-pyrimidin-1-yl)butanoic acid.
| Compound Name | 2-amino-4-(4-amino-2H-pyrimidin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 22326385 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-amino-4-(4-amino-2H-pyrimidin-1-yl)butanoic acid |
| SMILES | NC1=NCN(CCC(N)C(=O)O)C=C1 |
| InChI | InChI=1S/C8H14N4O2/c9-6(8(13)14)1-3-12-4-2-7(10)11-5-12/h2,4,6H,1,3,5,9H2,(H2,10,11)(H,13,14) |
| InChIKey | FSWXNNCNHCGAOO-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |