C14H24N6O4 — CID 5287874
(2R)-6-amino-2-[2-aminoethyl-[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]hexanoic acid (PubChem CID 5287874) has the molecular formula C14H24N6O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2R)-6-amino-2-[2-aminoethyl-[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]hexanoic acid.
| Compound Name | (2R)-6-amino-2-[2-aminoethyl-[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 5287874 |
| Molecular Formula | C14H24N6O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (2R)-6-amino-2-[2-aminoethyl-[2-(4-amino-2-oxopyrimidin-1-yl)acetyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](C(=O)O)N(CCN)C(=O)Cn1ccc(N)nc1=O |
| InChI | InChI=1S/C14H24N6O4/c15-5-2-1-3-10(13(22)23)20(8-6-16)12(21)9-19-7-4-11(17)18-14(19)24/h4,7,10H,1-3,5-6,8-9,15-16H2,(H,22,23)(H2,17,18,24)/t10-/m1/s1 |
| InChIKey | VSVRCXCSVDYVFE-SNVBAGLBSA-N |
| XLogP | -1.80 |
| TPSA | 170.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|