C11H14F3O4P — CID 175304100
(1,1,1-trifluoro-5-prop-2-ynyloct-7-yn-2-yl) dihydrogen phosphate (PubChem CID 175304100) has the molecular formula C11H14F3O4P and a molecular weight of 298.20 g/mol. Its IUPAC name is (1,1,1-trifluoro-5-prop-2-ynyloct-7-yn-2-yl) dihydrogen phosphate.
| Compound Name | (1,1,1-trifluoro-5-prop-2-ynyloct-7-yn-2-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 175304100 |
| Molecular Formula | C11H14F3O4P |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (1,1,1-trifluoro-5-prop-2-ynyloct-7-yn-2-yl) dihydrogen phosphate |
| SMILES | C#CCC(CC#C)CCC(OP(=O)(O)O)C(F)(F)F |
| InChI | InChI=1S/C11H14F3O4P/c1-3-5-9(6-4-2)7-8-10(11(12,13)14)18-19(15,16)17/h1-2,9-10H,5-8H2,(H2,15,16,17) |
| InChIKey | LNHPMEGMAJYLGJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|