C11H17F2O6P — CID 175353293
(1-but-3-en-2-yloxy-3-but-3-yn-2-yloxy-1,1-difluoropropan-2-yl) dihydrogen phosphate (PubChem CID 175353293) has the molecular formula C11H17F2O6P and a molecular weight of 314.22 g/mol. Its IUPAC name is (1-but-3-en-2-yloxy-3-but-3-yn-2-yloxy-1,1-difluoropropan-2-yl) dihydrogen phosphate.
| Compound Name | (1-but-3-en-2-yloxy-3-but-3-yn-2-yloxy-1,1-difluoropropan-2-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 175353293 |
| Molecular Formula | C11H17F2O6P |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (1-but-3-en-2-yloxy-3-but-3-yn-2-yloxy-1,1-difluoropropan-2-yl) dihydrogen phosphate |
| SMILES | C#CC(C)OCC(OP(=O)(O)O)C(F)(F)OC(C)C=C |
| InChI | InChI=1S/C11H17F2O6P/c1-5-8(3)17-7-10(19-20(14,15)16)11(12,13)18-9(4)6-2/h1,6,8-10H,2,7H2,3-4H3,(H2,14,15,16) |
| InChIKey | ZJCYHOMIMYPUCN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|