but-3-en-2-yloxy(ethenyl)phosphinic acid

C6H11O3P — CID 88761549

IUPACbut-3-en-2-yloxy(ethenyl)phosphinic acid
SMILESC=CC(C)OP(=O)(O)C=C
InChIInChI=1S/C6H11O3P/c1-4-6(3)9-10(7,8)5-2/h4-6H,1-2H2,3H3,(H,7,8)
InChIKeyHOXMOJAKDDKFEH-UHFFFAOYSA-N
MW162.12 g/mol
LogP1.91
Rot. Bonds4

About but-3-en-2-yloxy(ethenyl)phosphinic acid

but-3-en-2-yloxy(ethenyl)phosphinic acid (PubChem CID 88761549) has the molecular formula C6H11O3P and a molecular weight of 162.12 g/mol. Its IUPAC name is but-3-en-2-yloxy(ethenyl)phosphinic acid.

Molecular Properties

Compound Namebut-3-en-2-yloxy(ethenyl)phosphinic acid
PubChem CID88761549
Molecular FormulaC6H11O3P
Molecular Weight162.12 g/mol
Exact Mass162.04
IUPAC Namebut-3-en-2-yloxy(ethenyl)phosphinic acid
SMILESC=CC(C)OP(=O)(O)C=C
InChIInChI=1S/C6H11O3P/c1-4-6(3)9-10(7,8)5-2/h4-6H,1-2H2,3H3,(H,7,8)
InChIKeyHOXMOJAKDDKFEH-UHFFFAOYSA-N
XLogP1.91
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.12
LogP ≤ 51.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze but-3-en-2-yloxy(ethenyl)phosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

ethenyl(methoxy)phosphinic acid
CID 19693452
but-3-en-2-yloxy(1-phenylethenyl)phosphinic acid
CID 88759865
ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid
CID 158810817
ethenyl(octan-4-yloxy)phosphinic acid
CID 88822160
ethenyl(silyloxy)phosphinic acid
CID 174653832
ethenyl propan-2-yl hydrogen phosphate
CID 101139347
ethenyl(trimethoxysilyloxy)phosphinic acid
CID 141461361
[(2R)-but-3-en-2-yl] acetate
CID 11378468
5-methoxypent-1-en-3-yl dihydrogen phosphate
CID 175476467
3-[prop-2-ynoxy(prop-2-ynyl)phosphoryl]oxybut-1-ene
CID 175439589
but-3-en-2-yl ethyl carbonate
CID 11137281
phosphoric acid;prop-1-ene
CID 175586036

Frequently Asked Questions

What is the IUPAC name of but-3-en-2-yloxy(ethenyl)phosphinic acid?
The IUPAC name of but-3-en-2-yloxy(ethenyl)phosphinic acid (CID 88761549) is but-3-en-2-yloxy(ethenyl)phosphinic acid.
What is the SMILES notation for but-3-en-2-yloxy(ethenyl)phosphinic acid?
The canonical SMILES for but-3-en-2-yloxy(ethenyl)phosphinic acid is C=CC(C)OP(=O)(O)C=C.
What is the InChIKey of but-3-en-2-yloxy(ethenyl)phosphinic acid?
The InChIKey is HOXMOJAKDDKFEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11O3P/c1-4-6(3)9-10(7,8)5-2/h4-6H,1-2H2,3H3,(H,7,8).
What are the key properties of but-3-en-2-yloxy(ethenyl)phosphinic acid?
but-3-en-2-yloxy(ethenyl)phosphinic acid has a molecular weight of 162.12 g/mol, XLogP of 1.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-yloxy(ethenyl)phosphinic acid is sourced from PubChem (CID 88761549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).