ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid

C5H12O6P2 — CID 158810817

IUPACethenyl(methoxy)phosphinic acid;ethenylphosphonic acid
SMILESC=CP(=O)(O)O.C=CP(=O)(O)OC
InChIInChI=1S/C3H7O3P.C2H5O3P/c1-3-7(4,5)6-2;1-2-6(3,4)5/h3H,1H2,2H3,(H,4,5);2H,1H2,(H2,3,4,5)
InChIKeyIUQWYTAQFRFQCC-UHFFFAOYSA-N
MW230.09 g/mol
LogP1.27
Rot. Bonds3

About ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid

ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid (PubChem CID 158810817) has the molecular formula C5H12O6P2 and a molecular weight of 230.09 g/mol. Its IUPAC name is ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid.

Molecular Properties

Compound Nameethenyl(methoxy)phosphinic acid;ethenylphosphonic acid
PubChem CID158810817
Molecular FormulaC5H12O6P2
Molecular Weight230.09 g/mol
Exact Mass230.01
IUPAC Nameethenyl(methoxy)phosphinic acid;ethenylphosphonic acid
SMILESC=CP(=O)(O)O.C=CP(=O)(O)OC
InChIInChI=1S/C3H7O3P.C2H5O3P/c1-3-7(4,5)6-2;1-2-6(3,4)5/h3H,1H2,2H3,(H,4,5);2H,1H2,(H2,3,4,5)
InChIKeyIUQWYTAQFRFQCC-UHFFFAOYSA-N
XLogP1.27
TPSA104.06 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.09
LogP ≤ 51.27
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid?
The IUPAC name of ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid (CID 158810817) is ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid.
What is the SMILES notation for ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid?
The canonical SMILES for ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid is C=CP(=O)(O)O.C=CP(=O)(O)OC.
What is the InChIKey of ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid?
The InChIKey is IUQWYTAQFRFQCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O3P.C2H5O3P/c1-3-7(4,5)6-2;1-2-6(3,4)5/h3H,1H2,2H3,(H,4,5);2H,1H2,(H2,3,4,5).
What are the key properties of ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid?
ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid has a molecular weight of 230.09 g/mol, XLogP of 1.27, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(methoxy)phosphinic acid;ethenylphosphonic acid is sourced from PubChem (CID 158810817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).