C18H13ClFN5O3 — CID 175304291
2-chloro-N-[4-(4,5-diformamidoimidazol-1-yl)phenyl]-4-fluorobenzamide (PubChem CID 175304291) has the molecular formula C18H13ClFN5O3 and a molecular weight of 401.79 g/mol. Its IUPAC name is 2-chloro-N-[4-(4,5-diformamidoimidazol-1-yl)phenyl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[4-(4,5-diformamidoimidazol-1-yl)phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 175304291 |
| Molecular Formula | C18H13ClFN5O3 |
| Molecular Weight | 401.79 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-chloro-N-[4-(4,5-diformamidoimidazol-1-yl)phenyl]-4-fluorobenzamide |
| SMILES | O=CNc1ncn(-c2ccc(NC(=O)c3ccc(F)cc3Cl)cc2)c1NC=O |
| InChI | InChI=1S/C18H13ClFN5O3/c19-15-7-11(20)1-6-14(15)18(28)24-12-2-4-13(5-3-12)25-8-21-16(22-9-26)17(25)23-10-27/h1-10H,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | OITYQSNNAPDPRL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|