C12H21N5O4 — CID 175304570
2,6-diamino-12-azido-7,11-dioxododecanoic acid (PubChem CID 175304570) has the molecular formula C12H21N5O4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2,6-diamino-12-azido-7,11-dioxododecanoic acid.
| Compound Name | 2,6-diamino-12-azido-7,11-dioxododecanoic acid |
|---|---|
| PubChem CID | 175304570 |
| Molecular Formula | C12H21N5O4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2,6-diamino-12-azido-7,11-dioxododecanoic acid |
| SMILES | [N-]=[N+]=NCC(=O)CCCC(=O)C(N)CCCC(N)C(=O)O |
| InChI | InChI=1S/C12H21N5O4/c13-9(4-2-5-10(14)12(20)21)11(19)6-1-3-8(18)7-16-17-15/h9-10H,1-7,13-14H2,(H,20,21) |
| InChIKey | DJPOYVKMOUXVRS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 172.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|