C12H17BrN2O2 — CID 175305329
[1-(6-bromo-3-pyridinyl)-3,3-dimethylbutyl] carbamate (PubChem CID 175305329) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is [1-(6-bromo-3-pyridinyl)-3,3-dimethylbutyl] carbamate.
| Compound Name | [1-(6-bromo-3-pyridinyl)-3,3-dimethylbutyl] carbamate |
|---|---|
| PubChem CID | 175305329 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | [1-(6-bromo-3-pyridinyl)-3,3-dimethylbutyl] carbamate |
| SMILES | CC(C)(C)CC(OC(N)=O)c1ccc(Br)nc1 |
| InChI | InChI=1S/C12H17BrN2O2/c1-12(2,3)6-9(17-11(14)16)8-4-5-10(13)15-7-8/h4-5,7,9H,6H2,1-3H3,(H2,14,16) |
| InChIKey | VSFHRJDREMTSGZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|