C22H21NO2S — CID 175305873
4-methyl-N-[5-methyl-2-(1-phenylethenyl)phenyl]benzenesulfonamide (PubChem CID 175305873) has the molecular formula C22H21NO2S and a molecular weight of 363.48 g/mol. Its IUPAC name is 4-methyl-N-[5-methyl-2-(1-phenylethenyl)phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[5-methyl-2-(1-phenylethenyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175305873 |
| Molecular Formula | C22H21NO2S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-methyl-N-[5-methyl-2-(1-phenylethenyl)phenyl]benzenesulfonamide |
| SMILES | C=C(c1ccccc1)c1ccc(C)cc1NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H21NO2S/c1-16-9-12-20(13-10-16)26(24,25)23-22-15-17(2)11-14-21(22)18(3)19-7-5-4-6-8-19/h4-15,23H,3H2,1-2H3 |
| InChIKey | RCEJIMXVUWHGFP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |