C22H18FNO6S2 — CID 175307011
2-[[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]sulfonyl]benzoic acid (PubChem CID 175307011) has the molecular formula C22H18FNO6S2 and a molecular weight of 475.52 g/mol. Its IUPAC name is 2-[[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]sulfonyl]benzoic acid.
| Compound Name | 2-[[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 175307011 |
| Molecular Formula | C22H18FNO6S2 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | 2-[[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]sulfonyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1S(=O)(=O)c1ccc2c(c1)N(S(=O)(=O)c1ccc(F)cc1)CCC2 |
| InChI | InChI=1S/C22H18FNO6S2/c23-16-8-11-17(12-9-16)32(29,30)24-13-3-4-15-7-10-18(14-20(15)24)31(27,28)21-6-2-1-5-19(21)22(25)26/h1-2,5-12,14H,3-4,13H2,(H,25,26) |
| InChIKey | FDMQZEMKBVNOJL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |