C21H18FN3O6S2 — CID 43990523
N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]-2-nitrobenzenesulfonamide (PubChem CID 43990523) has the molecular formula C21H18FN3O6S2 and a molecular weight of 491.52 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 43990523 |
| Molecular Formula | C21H18FN3O6S2 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)Nc1ccc2c(c1)N(S(=O)(=O)c1ccc(F)cc1)CCC2 |
| InChI | InChI=1S/C21H18FN3O6S2/c22-16-8-11-18(12-9-16)33(30,31)24-13-3-4-15-7-10-17(14-20(15)24)23-32(28,29)21-6-2-1-5-19(21)25(26)27/h1-2,5-12,14,23H,3-4,13H2 |
| InChIKey | HCALFUCDMJETJG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|