C19H17N3O6S3 — CID 43955900
2-nitro-N-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)benzenesulfonamide (PubChem CID 43955900) has the molecular formula C19H17N3O6S3 and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-nitro-N-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)benzenesulfonamide.
| Compound Name | 2-nitro-N-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43955900 |
| Molecular Formula | C19H17N3O6S3 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | 2-nitro-N-(1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-quinolin-6-yl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)Nc1ccc2c(c1)CCCN2S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H17N3O6S3/c23-22(24)17-6-1-2-7-18(17)30(25,26)20-15-9-10-16-14(13-15)5-3-11-21(16)31(27,28)19-8-4-12-29-19/h1-2,4,6-10,12-13,20H,3,5,11H2 |
| InChIKey | NHQIASKEMZGBSO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|