C19H19N3O5S — CID 7517597
N-[1-(cyclopropanecarbonyl)-3,4-dihydro-2H-quinolin-7-yl]-2-nitrobenzenesulfonamide (PubChem CID 7517597) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is N-[1-(cyclopropanecarbonyl)-3,4-dihydro-2H-quinolin-7-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[1-(cyclopropanecarbonyl)-3,4-dihydro-2H-quinolin-7-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 7517597 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[1-(cyclopropanecarbonyl)-3,4-dihydro-2H-quinolin-7-yl]-2-nitrobenzenesulfonamide |
| SMILES | O=C(C1CC1)N1CCCc2ccc(NS(=O)(=O)c3ccccc3[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C19H19N3O5S/c23-19(14-7-8-14)21-11-3-4-13-9-10-15(12-17(13)21)20-28(26,27)18-6-2-1-5-16(18)22(24)25/h1-2,5-6,9-10,12,14,20H,3-4,7-8,11H2 |
| InChIKey | JUDNVOVPPVNLBY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|