C16H16ClFN2O4S2 — CID 43990533
1-chloro-N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]methanesulfonamide (PubChem CID 43990533) has the molecular formula C16H16ClFN2O4S2 and a molecular weight of 418.90 g/mol. Its IUPAC name is 1-chloro-N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]methanesulfonamide.
| Compound Name | 1-chloro-N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 43990533 |
| Molecular Formula | C16H16ClFN2O4S2 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | 1-chloro-N-[1-(4-fluorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-yl]methanesulfonamide |
| SMILES | O=S(=O)(CCl)Nc1ccc2c(c1)N(S(=O)(=O)c1ccc(F)cc1)CCC2 |
| InChI | InChI=1S/C16H16ClFN2O4S2/c17-11-25(21,22)19-14-6-3-12-2-1-9-20(16(12)10-14)26(23,24)15-7-4-13(18)5-8-15/h3-8,10,19H,1-2,9,11H2 |
| InChIKey | QFBRLJDMPRDECU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|