About zinc pentan-2-yl phosphite
zinc pentan-2-yl phosphite (PubChem CID 175309079) has the molecular formula C5H11O3PZn
and a molecular weight of 215.50 g/mol. Its IUPAC name is zinc pentan-2-yl phosphite.
Molecular Properties
| Compound Name | zinc pentan-2-yl phosphite |
| PubChem CID | 175309079 |
| Molecular Formula | C5H11O3PZn |
| Molecular Weight | 215.50 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | zinc pentan-2-yl phosphite |
| SMILES | CCCC(C)OP([O-])[O-].[Zn+2] |
| InChI | InChI=1S/C5H11O3P.Zn/c1-3-4-5(2)8-9(6)7;/h5H,3-4H2,1-2H3;/q-2;+2 |
| InChIKey | KKYFWTDOIDQGNC-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.50 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze zinc pentan-2-yl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc pentan-2-yl phosphite?
The IUPAC name of zinc pentan-2-yl phosphite (CID 175309079) is zinc pentan-2-yl phosphite.
What is the SMILES notation for zinc pentan-2-yl phosphite?
The canonical SMILES for zinc pentan-2-yl phosphite is CCCC(C)OP([O-])[O-].[Zn+2].
What is the InChIKey of zinc pentan-2-yl phosphite?
The InChIKey is KKYFWTDOIDQGNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O3P.Zn/c1-3-4-5(2)8-9(6)7;/h5H,3-4H2,1-2H3;/q-2;+2.
What are the key properties of zinc pentan-2-yl phosphite?
zinc pentan-2-yl phosphite has a molecular weight of 215.50 g/mol, XLogP of 0.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for zinc pentan-2-yl phosphite is sourced from PubChem (CID 175309079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).